Answered You can hire a professional tutor to get the answer.
Several reactions and their standard reaction enthalpies at 298.15 K are given here: CaC2(s)+2H2O(l)--Ca(OH)2(s)+C2H2(g) deltaHknot=-127.9kj/mol...
Several reactions and their standard reaction enthalpies at 298.15 K are given here:CaC2(s)+2H2O(l)-->Ca(OH)2(s)+C2H2(g) deltaHknot=-127.9kj/molCa(s)+(1/2)O2(g)-->CaO(s) deltaHknot=-635.1kj/molCaO(s)+H2O(l)-->Ca(OH)2(s) deltaHknot=-65.2kj/molThe standard enthalpies of combustion of graphite and C2H2(g) are –393.51 and –1299.58 kJ/mol, respectively. Calculate the standard enthalpy of formation of CaC2(s) at 25ºC
Several reactions and their standard reaction enthalpies at 298.15 K are given here:CaC2(s)+2H2O(l)-->Ca(OH)2(s)+C2H2(g) deltaHknot= -127.9kj/mol ……. iCa(s)+(1/2)O2(g)-->CaO(s)...